C12H20O5 — CID 102428596
(2R,3S,4R,5R,6R)-2-ethynyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane (PubChem CID 102428596) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-2-ethynyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane.
| Compound Name | (2R,3S,4R,5R,6R)-2-ethynyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 102428596 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (2R,3S,4R,5R,6R)-2-ethynyl-3,4,5-trimethoxy-6-(methoxymethyl)oxane |
| SMILES | C#C[C@H]1O[C@H](COC)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C12H20O5/c1-6-8-10(14-3)12(16-5)11(15-4)9(17-8)7-13-2/h1,8-12H,7H2,2-5H3/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | QRXOZJRYRZLJQC-RMPHRYRLSA-N |
| XLogP | 0.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|