C16H23N3O5 — CID 155657461
4-amino-1-[(2R,3S,5R)-3-but-3-ynoxy-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one (PubChem CID 155657461) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,5R)-3-but-3-ynoxy-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,5R)-3-but-3-ynoxy-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 155657461 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-amino-1-[(2R,3S,5R)-3-but-3-ynoxy-4-methoxy-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidin-2-one |
| SMILES | C#CCCO[C@H]1C(OC)[C@@H](COC)O[C@H]1n1cc(C)c(N)nc1=O |
| InChI | InChI=1S/C16H23N3O5/c1-5-6-7-23-13-12(22-4)11(9-21-3)24-15(13)19-8-10(2)14(17)18-16(19)20/h1,8,11-13,15H,6-7,9H2,2-4H3,(H2,17,18,20)/t11-,12?,13+,15-/m1/s1 |
| InChIKey | IBNSJEQHFRNFTJ-HCHQLJBOSA-N |
| XLogP | 0.10 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|