C15H25N3O5S — CID 88940506
4-amino-1-[(2R,5R)-4-methoxy-3-(2-methoxyethoxy)-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2-thione (PubChem CID 88940506) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-4-methoxy-3-(2-methoxyethoxy)-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2-thione.
| Compound Name | 4-amino-1-[(2R,5R)-4-methoxy-3-(2-methoxyethoxy)-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2-thione |
|---|---|
| PubChem CID | 88940506 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-amino-1-[(2R,5R)-4-methoxy-3-(2-methoxyethoxy)-5-(methoxymethyl)oxolan-2-yl]-5-methylpyrimidine-2-thione |
| SMILES | COCCOC1C(OC)[C@@H](COC)O[C@H]1n1cc(C)c(N)nc1=S |
| InChI | InChI=1S/C15H25N3O5S/c1-9-7-18(15(24)17-13(9)16)14-12(22-6-5-19-2)11(21-4)10(23-14)8-20-3/h7,10-12,14H,5-6,8H2,1-4H3,(H2,16,17,24)/t10-,11?,12?,14-/m1/s1 |
| InChIKey | LVVUOGIMJJHPHZ-MLCFOIATSA-N |
| XLogP | 1.09 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|