C16H28N3O8P — CID 122524984
[(2R,4S,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-(2-methoxyethoxy)-2-propyloxolan-3-yl] methyl hydrogen phosphate (PubChem CID 122524984) has the molecular formula C16H28N3O8P and a molecular weight of 421.39 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-(2-methoxyethoxy)-2-propyloxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-(2-methoxyethoxy)-2-propyloxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 122524984 |
| Molecular Formula | C16H28N3O8P |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [(2R,4S,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-4-(2-methoxyethoxy)-2-propyloxolan-3-yl] methyl hydrogen phosphate |
| SMILES | CCC[C@H]1O[C@@H](n2cc(C)c(N)nc2=O)[C@@H](OCCOC)C1OP(=O)(O)OC |
| InChI | InChI=1S/C16H28N3O8P/c1-5-6-11-12(27-28(21,22)24-4)13(25-8-7-23-3)15(26-11)19-9-10(2)14(17)18-16(19)20/h9,11-13,15H,5-8H2,1-4H3,(H,21,22)(H2,17,18,20)/t11-,12?,13+,15-/m1/s1 |
| InChIKey | IHBXIRLFLUFRGQ-HCHQLJBOSA-N |
| XLogP | 1.00 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|