C14H24FN3O7P+ — CID 11200274
2-[[(2R,3R,5R)-4-fluoro-3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 11200274) has the molecular formula C14H24FN3O7P+ and a molecular weight of 396.33 g/mol. Its IUPAC name is 2-[[(2R,3R,5R)-4-fluoro-3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R,3R,5R)-4-fluoro-3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11200274 |
| Molecular Formula | C14H24FN3O7P+ |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[[(2R,3R,5R)-4-fluoro-3-hydroxy-5-(2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OC[C@H]1O[C@@H](n2cccnc2=O)C(F)[C@@H]1O |
| InChI | InChI=1S/C14H23FN3O7P/c1-18(2,3)7-8-23-26(21,22)24-9-10-12(19)11(15)13(25-10)17-6-4-5-16-14(17)20/h4-6,10-13,19H,7-9H2,1-3H3/p+1/t10-,11?,12-,13-/m1/s1 |
| InChIKey | PZNAWIKDOHKLLK-PIBUBRJASA-O |
| XLogP | -0.32 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|