C10H14N5O6PS — CID 163199924
9-[(2R,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-4-hydroxyoxolan-2-yl]-2-imino-5H-purin-6-one (PubChem CID 163199924) has the molecular formula C10H14N5O6PS and a molecular weight of 363.29 g/mol. Its IUPAC name is 9-[(2R,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-4-hydroxyoxolan-2-yl]-2-imino-5H-purin-6-one.
| Compound Name | 9-[(2R,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-4-hydroxyoxolan-2-yl]-2-imino-5H-purin-6-one |
|---|---|
| PubChem CID | 163199924 |
| Molecular Formula | C10H14N5O6PS |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 9-[(2R,4R,5R)-5-(dihydroxyphosphinothioyloxymethyl)-4-hydroxyoxolan-2-yl]-2-imino-5H-purin-6-one |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@H]2C[C@@H](O)[C@@H](COP(O)(O)=S)O2)C(=O)N1 |
| InChI | InChI=1S/C10H14N5O6PS/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(21-6)2-20-22(18,19)23/h3-7,16H,1-2H2,(H2,11,14,17)(H2,18,19,23)/t4-,5-,6-,7?/m1/s1 |
| InChIKey | BEAMWINPDMALSI-RKEPMNIXSA-N |
| XLogP | -2.14 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|