C11H15N5O13P3-3 — CID 138962038
[[[(2S,3R,5R)-3-(hydroxymethyl)-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 138962038) has the molecular formula C11H15N5O13P3-3 and a molecular weight of 518.19 g/mol. Its IUPAC name is [[[(2S,3R,5R)-3-(hydroxymethyl)-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2S,3R,5R)-3-(hydroxymethyl)-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 138962038 |
| Molecular Formula | C11H15N5O13P3-3 |
| Molecular Weight | 518.19 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | [[[(2S,3R,5R)-3-(hydroxymethyl)-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@H]2C[C@H](CO)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O2)C(=O)N1 |
| InChI | InChI=1S/C11H18N5O13P3/c12-11-14-9-8(10(18)15-11)13-4-16(9)7-1-5(2-17)6(27-7)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h4-8,17H,1-3H2,(H,22,23)(H,24,25)(H2,12,15,18)(H2,19,20,21)/p-3/t5-,6-,7-,8?/m1/s1 |
| InChIKey | YLYWVTXELTWXLY-XDTPYFJJSA-K |
| XLogP | -3.67 |
| TPSA | 278.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.19 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|