C11H14N4O13P3-3 — CID 147859884
[[[(2R,5R)-3-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 147859884) has the molecular formula C11H14N4O13P3-3 and a molecular weight of 503.17 g/mol. Its IUPAC name is [[[(2R,5R)-3-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,5R)-3-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 147859884 |
| Molecular Formula | C11H14N4O13P3-3 |
| Molecular Weight | 503.17 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | [[[(2R,5R)-3-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | COC1C[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@H]1COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O |
| InChI | InChI=1S/C11H17N4O13P3/c1-24-6-2-8(15-5-14-9-10(15)12-4-13-11(9)16)26-7(6)3-25-30(20,21)28-31(22,23)27-29(17,18)19/h4-8H,2-3H2,1H3,(H,20,21)(H,22,23)(H,12,13,16)(H2,17,18,19)/p-3/t6?,7-,8-/m1/s1 |
| InChIKey | HWMATTLIRSSCGT-SPDVFEMOSA-K |
| XLogP | -2.13 |
| TPSA | 250.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.17 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|