C7H14O12P3-3 — CID 59137937
[[(3-methoxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 59137937) has the molecular formula C7H14O12P3-3 and a molecular weight of 383.10 g/mol. Its IUPAC name is [[(3-methoxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[(3-methoxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 59137937 |
| Molecular Formula | C7H14O12P3-3 |
| Molecular Weight | 383.10 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | [[(3-methoxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | COC1CC(C)OC1COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O |
| InChI | InChI=1S/C7H17O12P3/c1-5-3-6(15-2)7(17-5)4-16-21(11,12)19-22(13,14)18-20(8,9)10/h5-7H,3-4H2,1-2H3,(H,11,12)(H,13,14)(H2,8,9,10)/p-3 |
| InChIKey | GHTTWYJARHGUSD-UHFFFAOYSA-K |
| XLogP | -1.37 |
| TPSA | 186.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.10 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|