C11H20N4O13P3-3 — CID 147696534
[[[(2R,3R,5S)-3-(3-acetamido-1-azidopropoxy)-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 147696534) has the molecular formula C11H20N4O13P3-3 and a molecular weight of 509.22 g/mol. Its IUPAC name is [[[(2R,3R,5S)-3-(3-acetamido-1-azidopropoxy)-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,3R,5S)-3-(3-acetamido-1-azidopropoxy)-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 147696534 |
| Molecular Formula | C11H20N4O13P3-3 |
| Molecular Weight | 509.22 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | [[[(2R,3R,5S)-3-(3-acetamido-1-azidopropoxy)-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | CC(=O)NCCC(N=[N+]=[N-])O[C@@H]1C[C@H](C)O[C@@H]1COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O |
| InChI | InChI=1S/C11H23N4O13P3/c1-7-5-9(26-11(14-15-12)3-4-13-8(2)16)10(25-7)6-24-30(20,21)28-31(22,23)27-29(17,18)19/h7,9-11H,3-6H2,1-2H3,(H,13,16)(H,20,21)(H,22,23)(H2,17,18,19)/p-3/t7-,9+,10+,11?/m0/s1 |
| InChIKey | GRZXZGVRNVLWMW-NCVFYZNSSA-K |
| XLogP | -0.84 |
| TPSA | 264.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.22 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|