C11H16ClN5O13P3- — CID 154732911
[[[(2R,3R,4R,5R)-4-chloro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 154732911) has the molecular formula C11H16ClN5O13P3- and a molecular weight of 554.65 g/mol. Its IUPAC name is [[[(2R,3R,4R,5R)-4-chloro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,3R,4R,5R)-4-chloro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 154732911 |
| Molecular Formula | C11H16ClN5O13P3- |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 553.97 |
| IUPAC Name | [[[(2R,3R,4R,5R)-4-chloro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)[C@@H](O)[C@@]2(C)Cl)C(=O)N1 |
| InChI | InChI=1S/C11H17ClN5O13P3/c1-11(12)6(18)4(2-27-32(23,24)30-33(25,26)29-31(20,21)22)28-9(11)17-3-14-5-7(17)15-10(13)16-8(5)19/h3-6,9,18H,2H2,1H3,(H,23,24)(H,25,26)(H2,13,16,19)(H2,20,21,22)/p-1/t4-,5?,6-,9-,11-/m1/s1 |
| InChIKey | ZLJMNMRQNRPEOE-WDLLHSDVSA-M |
| XLogP | -2.04 |
| TPSA | 273.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|