C12H14F2N5O13P3 — CID 155922385
[[(2S,3S,4R,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155922385) has the molecular formula C12H14F2N5O13P3 and a molecular weight of 567.18 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155922385 |
| Molecular Formula | C12H14F2N5O13P3 |
| Molecular Weight | 567.18 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | [[(2S,3S,4R,5R)-4-ethynyl-2,4-difluoro-3-hydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@@H]2O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]2(F)C#C)C(=O)N1 |
| InChI | InChI=1S/C12H14F2N5O13P3/c1-2-11(13)8(21)12(14,3-29-34(25,26)32-35(27,28)31-33(22,23)24)30-9(11)19-4-16-5-6(19)17-10(15)18-7(5)20/h1,4-5,8-9,21H,3H2,(H,25,26)(H,27,28)(H2,15,18,20)(H2,22,23,24)/t5?,8-,9+,11+,12+/m0/s1 |
| InChIKey | GXWMCQHPIVWLCS-NSAFPCEHSA-N |
| XLogP | -1.77 |
| TPSA | 270.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.18 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|