C12H15ClFN4O12P3-2 — CID 147790216
[[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate (PubChem CID 147790216) has the molecular formula C12H15ClFN4O12P3-2 and a molecular weight of 554.64 g/mol. Its IUPAC name is [[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate.
| Compound Name | [[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 147790216 |
| Molecular Formula | C12H15ClFN4O12P3-2 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | [[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| SMILES | C[C@@]1(Cl)[C@H](O)[C@@H](COP(=O)(O)OP(=O)([O-])OP(=O)([O-])O)O[C@H]1n1cc(F)c2c(N)ncnc21 |
| InChI | InChI=1S/C12H17ClFN4O12P3/c1-12(13)8(19)6(3-27-32(23,24)30-33(25,26)29-31(20,21)22)28-11(12)18-2-5(14)7-9(15)16-4-17-10(7)18/h2,4,6,8,11,19H,3H2,1H3,(H,23,24)(H,25,26)(H2,15,16,17)(H2,20,21,22)/p-2/t6-,8-,11-,12-/m1/s1 |
| InChIKey | HJMGQTGDWUZHMR-YUTYNTIBSA-L |
| XLogP | -0.51 |
| TPSA | 251.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|