C18H28FN5O8P2 — CID 130470088
propan-2-yl (2S)-2-[[[(2R,3S,4R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phosphanyloxyphosphoryl]amino]propanoate (PubChem CID 130470088) has the molecular formula C18H28FN5O8P2 and a molecular weight of 523.40 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phosphanyloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phosphanyloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130470088 |
| Molecular Formula | C18H28FN5O8P2 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phosphanyloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OP)OC[C@H]1OC(n2cc(F)c3c(N)ncnc32)[C@](C)(O)[C@H]1O |
| InChI | InChI=1S/C18H28FN5O8P2/c1-8(2)30-16(26)9(3)23-34(28,32-33)29-6-11-13(25)18(4,27)17(31-11)24-5-10(19)12-14(20)21-7-22-15(12)24/h5,7-9,11,13,17,25,27H,6,33H2,1-4H3,(H,23,28)(H2,20,21,22)/t9-,11+,13-,17?,18+,34?/m0/s1 |
| InChIKey | SXNSCAAYYBFIHK-BUIXRKRNSA-N |
| XLogP | 1.02 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|