C10H15N3O5 — CID 126578665
3-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyridin-2-one (PubChem CID 126578665) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyridin-2-one.
| Compound Name | 3-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyridin-2-one |
|---|---|
| PubChem CID | 126578665 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-amino-1-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-iminopyridin-2-one |
| SMILES | [H]/N=C1\C=CN([C@@H]2O[C@H](CO)[C@H](O)C2O)C(=O)C1N |
| InChI | InChI=1S/C10H15N3O5/c11-4-1-2-13(9(17)6(4)12)10-8(16)7(15)5(3-14)18-10/h1-2,5-8,10-11,14-16H,3,12H2/b11-4+/t5-,6?,7+,8?,10-/m1/s1 |
| InChIKey | KSNILMKRQXOGNO-KGRFSNQOSA-N |
| XLogP | -2.87 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|