C11H17N3O4 — CID 58706071
(2R,4R,5R)-2-(2,4-dimethyl-6-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 58706071) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2R,4R,5R)-2-(2,4-dimethyl-6-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-(2,4-dimethyl-6-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 58706071 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (2R,4R,5R)-2-(2,4-dimethyl-6-methylidene-1,3,5-triazin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C=C1N=C(C)N=C(C)N1[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C11H17N3O4/c1-5-12-6(2)14(7(3)13-5)11-10(17)9(16)8(4-15)18-11/h8-11,15-17H,2,4H2,1,3H3/t8-,9+,10?,11-/m1/s1 |
| InChIKey | OIMWRNQORHYRPX-KJLIAQIISA-N |
| XLogP | -0.95 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |