C12H17N5O4 — CID 174642180
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-2,5-dimethylpurin-9-yl)oxolane-3,4-diol (PubChem CID 174642180) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-2,5-dimethylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-2,5-dimethylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174642180 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-2,5-dimethylpurin-9-yl)oxolane-3,4-diol |
| SMILES | [H]/N=C1\N=C(C)N=C2N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC21C |
| InChI | InChI=1S/C12H17N5O4/c1-5-15-10(13)12(2)11(16-5)17(4-14-12)9-8(20)7(19)6(3-18)21-9/h4,6-9,13,18-20H,3H2,1-2H3/b13-10-/t6-,7-,8-,9-,12?/m1/s1 |
| InChIKey | SCXNLEFTXHSDQH-XPSRNYAUSA-N |
| XLogP | -1.66 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|