C10H16N6O4 — CID 67350682
(2R,3R,4S,5R)-2-(5,6-diamino-2H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67350682) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(5,6-diamino-2H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(5,6-diamino-2H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67350682 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-(5,6-diamino-2H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NC1=NCN=C2N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC12N |
| InChI | InChI=1S/C10H16N6O4/c11-8-10(12)9(14-2-13-8)16(3-15-10)7-6(19)5(18)4(1-17)20-7/h3-7,17-19H,1-2,12H2,(H2,11,13)/t4-,5-,6-,7-,10?/m1/s1 |
| InChIKey | DNTQTGXZQJJAIL-DKZDHXMOSA-N |
| XLogP | -3.85 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |