C12H18FN5O3S — CID 46876310
(3R,4S,5S)-2-(6-amino-2,5-dihydropurin-9-yl)-5-(2-fluoroethylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 46876310) has the molecular formula C12H18FN5O3S and a molecular weight of 331.37 g/mol. Its IUPAC name is (3R,4S,5S)-2-(6-amino-2,5-dihydropurin-9-yl)-5-(2-fluoroethylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5S)-2-(6-amino-2,5-dihydropurin-9-yl)-5-(2-fluoroethylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876310 |
| Molecular Formula | C12H18FN5O3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (3R,4S,5S)-2-(6-amino-2,5-dihydropurin-9-yl)-5-(2-fluoroethylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | NC1=NCN=C2C1N=CN2C1O[C@H](CSCCF)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H18FN5O3S/c13-1-2-22-3-6-8(19)9(20)12(21-6)18-5-17-7-10(14)15-4-16-11(7)18/h5-9,12,19-20H,1-4H2,(H2,14,15)/t6-,7?,8-,9-,12?/m1/s1 |
| InChIKey | UJWBZJFXMHUALT-KPAKYIHDSA-N |
| XLogP | -1.42 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|