C10H15N5O5S — CID 167994108
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-purine-6-thione;hydrate (PubChem CID 167994108) has the molecular formula C10H15N5O5S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-purine-6-thione;hydrate.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-purine-6-thione;hydrate |
|---|---|
| PubChem CID | 167994108 |
| Molecular Formula | C10H15N5O5S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-purine-6-thione;hydrate |
| SMILES | NC1=NC(=S)C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=N1.O |
| InChI | InChI=1S/C10H13N5O4S.H2O/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;/h2-6,9,16-18H,1H2,(H2,11,14,20);1H2/t3-,4?,5-,6-,9-;/m1./s1 |
| InChIKey | CUYIZHOOMVDOIC-XXSBUZCCSA-N |
| XLogP | -3.63 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|