C11H18N5NaO13P3 — CID 45055357
CID 45055357 (PubChem CID 45055357) has the molecular formula C11H18N5NaO13P3 and a molecular weight of 544.20 g/mol.
| Compound Name | CID 45055357 |
|---|---|
| PubChem CID | 45055357 |
| Molecular Formula | C11H18N5NaO13P3 |
| Molecular Weight | 544.20 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | — |
| SMILES | NC1=NC(=O)C2N=CN(C3OC(COP(=O)(O)OP(=O)(O)CP(=O)(O)O)C(O)C3O)C2=N1.[Na] |
| InChI | InChI=1S/C11H18N5O13P3.Na/c12-11-14-8-5(9(19)15-11)13-2-16(8)10-7(18)6(17)4(28-10)1-27-32(25,26)29-31(23,24)3-30(20,21)22;/h2,4-7,10,17-18H,1,3H2,(H,23,24)(H,25,26)(H2,12,15,19)(H2,20,21,22); |
| InChIKey | HQTYOUVOHFLZSI-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 283.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.20 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|