C10H11N4Na2O8P — CID 73179537
disodium;[3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate (PubChem CID 73179537) has the molecular formula C10H11N4Na2O8P and a molecular weight of 392.17 g/mol. Its IUPAC name is disodium;[3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 73179537 |
| Molecular Formula | C10H11N4Na2O8P |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | disodium;[3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate |
| SMILES | O=C1N=CN=C2C1N=CN2C1OC(COP(=O)([O-])[O-])C(O)C1O.[Na+].[Na+] |
| InChI | InChI=1S/C10H13N4O8P.2Na/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17;;/h2-7,10,15-16H,1H2,(H2,18,19,20);;/q;2*+1/p-2 |
| InChIKey | NTVXBXKHNUCPKQ-UHFFFAOYSA-L |
| XLogP | -10.03 |
| TPSA | 179.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | -10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|