C10H15N5Na2O11P2 — CID 175757533
disodium;(2R,3R,4S,5R)-2-(5-deuterio-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphono phosphate (PubChem CID 175757533) has the molecular formula C10H15N5Na2O11P2 and a molecular weight of 490.19 g/mol. Its IUPAC name is disodium;(2R,3R,4S,5R)-2-(5-deuterio-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphono phosphate.
| Compound Name | disodium;(2R,3R,4S,5R)-2-(5-deuterio-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphono phosphate |
|---|---|
| PubChem CID | 175757533 |
| Molecular Formula | C10H15N5Na2O11P2 |
| Molecular Weight | 490.19 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | disodium;(2R,3R,4S,5R)-2-(5-deuterio-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphono phosphate |
| SMILES | O=P([O-])([O-])OP(=O)(O)O.[H]/N=C1\N=CN=C2N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC21[2H].[Na+].[Na+] |
| InChI | InChI=1S/C10H13N5O4.2Na.H4O7P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;;;1-8(2,3)7-9(4,5)6/h2-7,10-11,16-18H,1H2;;;(H2,1,2,3)(H2,4,5,6)/q;2*+1;/p-2/b11-8-;;;/t4-,5?,6-,7-,10-;;;/m1.../s1/i5D;;; |
| InChIKey | WPYGSSOYKVONQE-MPNHTSATSA-L |
| XLogP | -10.51 |
| TPSA | 264.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.19 |
| LogP ≤ 5 | -10.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|