C11H15F2N5O10P2 — CID 154108022
[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-5-yl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 154108022) has the molecular formula C11H15F2N5O10P2 and a molecular weight of 477.21 g/mol. Its IUPAC name is [[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-5-yl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-5-yl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 154108022 |
| Molecular Formula | C11H15F2N5O10P2 |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | [[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-5-yl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | [H]/N=C1\N=CN=C2N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC21OP(=O)(O)C(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C11H15F2N5O10P2/c12-11(13,29(22,23)24)30(25,26)28-10-8(14)15-2-16-9(10)18(3-17-10)7-6(21)5(20)4(1-19)27-7/h2-7,14,19-21H,1H2,(H,25,26)(H2,22,23,24)/b14-8-/t4-,5-,6-,7-,10?/m1/s1 |
| InChIKey | WSCUSDONOVXAAS-CBLVGYDXSA-N |
| XLogP | -2.19 |
| TPSA | 238.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|