C10H12FN5O3 — CID 138811082
(2R,3S,5R)-5-(5-fluoro-6-iminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 138811082) has the molecular formula C10H12FN5O3 and a molecular weight of 269.24 g/mol. Its IUPAC name is (2R,3S,5R)-5-(5-fluoro-6-iminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(5-fluoro-6-iminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 138811082 |
| Molecular Formula | C10H12FN5O3 |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2R,3S,5R)-5-(5-fluoro-6-iminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [H]/N=C1\N=CN=C2N([C@H]3C[C@H](O)[C@@H](CO)O3)C=NC21F |
| InChI | InChI=1S/C10H12FN5O3/c11-10-8(12)13-3-14-9(10)16(4-15-10)7-1-5(18)6(2-17)19-7/h3-7,12,17-18H,1-2H2/b12-8-/t5-,6+,7+,10?/m0/s1 |
| InChIKey | MWXGFPFZQGYZBH-UEOSYRLPSA-N |
| XLogP | -1.12 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|