C10H11IN4O4 — CID 141239616
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopurin-6-one (PubChem CID 141239616) has the molecular formula C10H11IN4O4 and a molecular weight of 378.13 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopurin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopurin-6-one |
|---|---|
| PubChem CID | 141239616 |
| Molecular Formula | C10H11IN4O4 |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopurin-6-one |
| SMILES | O=C1N=CN=C2N([C@H]3C[C@H](O)[C@@H](CO)O3)C=NC12I |
| InChI | InChI=1S/C10H11IN4O4/c11-10-8(12-3-13-9(10)18)15(4-14-10)7-1-5(17)6(2-16)19-7/h3-7,16-17H,1-2H2/t5-,6+,7+,10?/m0/s1 |
| InChIKey | DFSUJVMSUXABFD-PLDAJOQYSA-N |
| XLogP | -1.10 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|