C15H19F3N5O5P — CID 140999971
[(2R,3R,4S,5R)-5-(5-difluorophosphoryl-6-iminopurin-9-yl)-3-fluoro-4-(oxan-2-yloxy)oxolan-2-yl]methanol (PubChem CID 140999971) has the molecular formula C15H19F3N5O5P and a molecular weight of 437.32 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(5-difluorophosphoryl-6-iminopurin-9-yl)-3-fluoro-4-(oxan-2-yloxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R)-5-(5-difluorophosphoryl-6-iminopurin-9-yl)-3-fluoro-4-(oxan-2-yloxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 140999971 |
| Molecular Formula | C15H19F3N5O5P |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(5-difluorophosphoryl-6-iminopurin-9-yl)-3-fluoro-4-(oxan-2-yloxy)oxolan-2-yl]methanol |
| SMILES | [H]/N=C1\N=CN=C2N([C@@H]3O[C@H](CO)[C@@H](F)[C@H]3OC3CCCCO3)C=NC21P(=O)(F)F |
| InChI | InChI=1S/C15H19F3N5O5P/c16-10-8(5-24)27-12(11(10)28-9-3-1-2-4-26-9)23-7-22-15(29(17,18)25)13(19)20-6-21-14(15)23/h6-12,19,24H,1-5H2/b19-13-/t8-,9?,10-,11-,12-,15?/m1/s1 |
| InChIKey | KAWNLGBCDGVLAC-KFCOWNLFSA-N |
| XLogP | 1.54 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|