C22H28FN5O6 — CID 140531808
9-[(2R,3R,4S,5R)-3-ethynyl-3-fluoro-5-(hydroxymethyl)-4-(oxan-2-yloxy)oxolan-2-yl]-2-(oxan-2-ylamino)-1H-purin-6-one (PubChem CID 140531808) has the molecular formula C22H28FN5O6 and a molecular weight of 477.49 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3-ethynyl-3-fluoro-5-(hydroxymethyl)-4-(oxan-2-yloxy)oxolan-2-yl]-2-(oxan-2-ylamino)-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-3-ethynyl-3-fluoro-5-(hydroxymethyl)-4-(oxan-2-yloxy)oxolan-2-yl]-2-(oxan-2-ylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 140531808 |
| Molecular Formula | C22H28FN5O6 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3-ethynyl-3-fluoro-5-(hydroxymethyl)-4-(oxan-2-yloxy)oxolan-2-yl]-2-(oxan-2-ylamino)-1H-purin-6-one |
| SMILES | C#C[C@@]1(F)[C@@H](OC2CCCCO2)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(NC3CCCCO3)nc21 |
| InChI | InChI=1S/C22H28FN5O6/c1-2-22(23)17(34-15-8-4-6-10-32-15)13(11-29)33-20(22)28-12-24-16-18(28)26-21(27-19(16)30)25-14-7-3-5-9-31-14/h1,12-15,17,20,29H,3-11H2,(H2,25,26,27,30)/t13-,14?,15?,17+,20-,22-/m1/s1 |
| InChIKey | HUUFOVLAKWJEGW-CZFISCNHSA-N |
| XLogP | 1.20 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|