C16H19FN6O3 — CID 122527474
(2R,3R,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethynyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 122527474) has the molecular formula C16H19FN6O3 and a molecular weight of 362.37 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethynyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethynyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 122527474 |
| Molecular Formula | C16H19FN6O3 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2R,3R,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethynyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#C[C@@]1(F)[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N(C)C3CC3)nc(N)nc21 |
| InChI | InChI=1S/C16H19FN6O3/c1-3-16(17)11(25)9(6-24)26-14(16)23-7-19-10-12(22(2)8-4-5-8)20-15(18)21-13(10)23/h1,7-9,11,14,24-25H,4-6H2,2H3,(H2,18,20,21)/t9-,11-,14-,16-/m1/s1 |
| InChIKey | WWDFTEWBDIWPFT-ROMFRFKVSA-N |
| XLogP | -0.40 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|