C14H19FN6O3 — CID 141499837
5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-fluoro-4-methyloxolane-3,3-diol (PubChem CID 141499837) has the molecular formula C14H19FN6O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is 5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-fluoro-4-methyloxolane-3,3-diol.
| Compound Name | 5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-fluoro-4-methyloxolane-3,3-diol |
|---|---|
| PubChem CID | 141499837 |
| Molecular Formula | C14H19FN6O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-fluoro-4-methyloxolane-3,3-diol |
| SMILES | CN(c1nc(N)nc2c1ncn2C1OCC(O)(O)C1(C)F)C1CC1 |
| InChI | InChI=1S/C14H19FN6O3/c1-13(15)11(24-5-14(13,22)23)21-6-17-8-9(20(2)7-3-4-7)18-12(16)19-10(8)21/h6-7,11,22-23H,3-5H2,1-2H3,(H2,16,18,19) |
| InChIKey | PHWOUUQMKZDYHS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|