C17H27N6O12P3 — CID 139294631
[[(2R,3S,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 139294631) has the molecular formula C17H27N6O12P3 and a molecular weight of 600.36 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 139294631 |
| Molecular Formula | C17H27N6O12P3 |
| Molecular Weight | 600.36 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-amino-6-[cyclopropyl(methyl)amino]purin-9-yl]-4-ethenyl-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C[C@]1(C)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(N(C)C3CC3)nc(N)nc21 |
| InChI | InChI=1S/C17H27N6O12P3/c1-4-17(2)12(24)10(7-32-37(28,29)35-38(30,31)34-36(25,26)27)33-15(17)23-8-19-11-13(22(3)9-5-6-9)20-16(18)21-14(11)23/h4,8-10,12,15,24H,1,5-7H2,2-3H3,(H,28,29)(H,30,31)(H2,18,20,21)(H2,25,26,27)/t10-,12-,15-,17-/m1/s1 |
| InChIKey | KKFYBTFBVBVIBK-HDXACZHMSA-N |
| XLogP | 0.80 |
| TPSA | 262.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|