C11H14N5O14P3-4 — CID 122214397
[[[(2R,3R,4R,5R)-5-(2-amino-6-oxidopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-hydroxyphosphoryl] phosphate (PubChem CID 122214397) has the molecular formula C11H14N5O14P3-4 and a molecular weight of 533.18 g/mol. Its IUPAC name is [[[(2R,3R,4R,5R)-5-(2-amino-6-oxidopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-hydroxyphosphoryl] phosphate.
| Compound Name | [[[(2R,3R,4R,5R)-5-(2-amino-6-oxidopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-hydroxyphosphoryl] phosphate |
|---|---|
| PubChem CID | 122214397 |
| Molecular Formula | C11H14N5O14P3-4 |
| Molecular Weight | 533.18 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | [[[(2R,3R,4R,5R)-5-(2-amino-6-oxidopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-hydroxyphosphoryl] phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)([O-])OP(=O)(O)OP(=O)([O-])[O-])O[C@H]1n1cnc2c([O-])nc(N)nc21 |
| InChI | InChI=1S/C11H18N5O14P3/c1-11(19)6(17)4(2-27-32(23,24)30-33(25,26)29-31(20,21)22)28-9(11)16-3-13-5-7(16)14-10(12)15-8(5)18/h3-4,6,9,17,19H,2H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)(H3,12,14,15,18)/p-4/t4-,6-,9-,11-/m1/s1 |
| InChIKey | XIWOELIBNPGBLO-GITKWUPZSA-J |
| XLogP | -4.06 |
| TPSA | 310.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.18 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|