C12H19N5O5 — CID 175490734
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dimethyl-1H-purin-6-one (PubChem CID 175490734) has the molecular formula C12H19N5O5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dimethyl-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dimethyl-1H-purin-6-one |
|---|---|
| PubChem CID | 175490734 |
| Molecular Formula | C12H19N5O5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,5-dimethyl-1H-purin-6-one |
| SMILES | CC1(N)N=C2N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=NC2(C)C(=O)N1 |
| InChI | InChI=1S/C12H19N5O5/c1-11-9(15-12(2,13)16-10(11)21)17(4-14-11)8-7(20)6(19)5(3-18)22-8/h4-8,18-20H,3,13H2,1-2H3,(H,16,21)/t5-,6-,7-,8-,11?,12?/m1/s1 |
| InChIKey | IDLZYIQMYKXYRW-MWYUYAJZSA-N |
| XLogP | -3.31 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |