C11H16N6O4S — CID 45269747
(2R,3R,4S,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 45269747) has the molecular formula C11H16N6O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 45269747 |
| Molecular Formula | C11H16N6O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (2R,3R,4S,5S)-2-(7-aminotriazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1nnn2[C@@H]1O[C@H](CSCCO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16N6O4S/c12-9-6-10(14-4-13-9)17(16-15-6)11-8(20)7(19)5(21-11)3-22-2-1-18/h4-5,7-8,11,18-20H,1-3H2,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | YRKMJWWITSJWGE-IOSLPCCCSA-N |
| XLogP | -1.85 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|