C10H14NO8P — CID 3274684
[3,4-dihydroxy-5-(4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 3274684) has the molecular formula C10H14NO8P and a molecular weight of 307.20 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [3,4-dihydroxy-5-(4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 3274684 |
| Molecular Formula | C10H14NO8P |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | [3,4-dihydroxy-5-(4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1ccn(C2OC(COP(=O)(O)O)C(O)C2O)cc1 |
| InChI | InChI=1S/C10H14NO8P/c12-6-1-3-11(4-2-6)10-9(14)8(13)7(19-10)5-18-20(15,16)17/h1-4,7-10,13-14H,5H2,(H2,15,16,17) |
| InChIKey | SMHHXNJIRLTYFN-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|