C8H14N3O7P — CID 11335428
[(2R,3S,4R,5R)-5-(5-aminoimidazol-1-yl)-3,4-dihydroxy(413C)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 11335428) has the molecular formula C8H14N3O7P and a molecular weight of 296.18 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-aminoimidazol-1-yl)-3,4-dihydroxy(413C)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-aminoimidazol-1-yl)-3,4-dihydroxy(413C)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 11335428 |
| Molecular Formula | C8H14N3O7P |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-aminoimidazol-1-yl)-3,4-dihydroxy(413C)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Nc1cncn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[13C@H]1O |
| InChI | InChI=1S/C8H14N3O7P/c9-5-1-10-3-11(5)8-7(13)6(12)4(18-8)2-17-19(14,15)16/h1,3-4,6-8,12-13H,2,9H2,(H2,14,15,16)/t4-,6-,7-,8-/m1/s1/i7+1 |
| InChIKey | PDACUKOKVHBVHJ-OGBLAGJQSA-N |
| XLogP | -1.81 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|