C30H31IN2O8 — CID 74408739
1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-5-iodo-1,3-diazinane-2,4-dione (PubChem CID 74408739) has the molecular formula C30H31IN2O8 and a molecular weight of 674.49 g/mol. Its IUPAC name is 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-5-iodo-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-5-iodo-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 74408739 |
| Molecular Formula | C30H31IN2O8 |
| Molecular Weight | 674.49 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | 1-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-5-iodo-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(C(OCC2OC(N3CC(I)C(=O)NC3=O)C(O)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H31IN2O8/c1-38-21-12-8-19(9-13-21)30(18-6-4-3-5-7-18,20-10-14-22(39-2)15-11-20)40-17-24-25(34)26(35)28(41-24)33-16-23(31)27(36)32-29(33)37/h3-15,23-26,28,34-35H,16-17H2,1-2H3,(H,32,36,37) |
| InChIKey | QGNBNMCPGIJJIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|