C33H35N5O7 — CID 154519411
1-[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-8H-purin-6-yl]ethanone (PubChem CID 154519411) has the molecular formula C33H35N5O7 and a molecular weight of 613.67 g/mol. Its IUPAC name is 1-[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-8H-purin-6-yl]ethanone.
| Compound Name | 1-[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-8H-purin-6-yl]ethanone |
|---|---|
| PubChem CID | 154519411 |
| Molecular Formula | C33H35N5O7 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 1-[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-8H-purin-6-yl]ethanone |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3CN=C4C3=NC=NC4(N)C(C)=O)[C@H](O)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H35N5O7/c1-20(39)33(34)29-30(35-18-37-33)38(19-36-29)31-28(41)27(40)26(45-31)17-44-32(21-7-5-4-6-8-21,22-9-13-24(42-2)14-10-22)23-11-15-25(43-3)16-12-23/h4-16,18,26-28,31,40-41H,17,19,34H2,1-3H3/t26-,27-,28-,31-,33?/m1/s1 |
| InChIKey | UKEDBFFKBMDHNG-VGEKKNJFSA-N |
| XLogP | 1.86 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|