C11H24N2O13P2 — CID 124919031
[(2R,3S,4R,5R)-5-[(2S,5R,6R)-2,6-dihydroxy-5-methoxy-3-methyl-1,3-diazinan-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 124919031) has the molecular formula C11H24N2O13P2 and a molecular weight of 454.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[(2S,5R,6R)-2,6-dihydroxy-5-methoxy-3-methyl-1,3-diazinan-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[(2S,5R,6R)-2,6-dihydroxy-5-methoxy-3-methyl-1,3-diazinan-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 124919031 |
| Molecular Formula | C11H24N2O13P2 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[(2S,5R,6R)-2,6-dihydroxy-5-methoxy-3-methyl-1,3-diazinan-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CO[C@@H]1CN(C)[C@H](O)N([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C11H24N2O13P2/c1-12-3-5(23-2)9(16)13(11(12)17)10-8(15)7(14)6(25-10)4-24-28(21,22)26-27(18,19)20/h5-11,14-17H,3-4H2,1-2H3,(H,21,22)(H2,18,19,20)/t5-,6-,7-,8-,9-,10-,11+/m1/s1 |
| InChIKey | IVDFBLDOBYDKDL-BAGIKHCGSA-N |
| XLogP | -3.48 |
| TPSA | 219.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|