C11H17N2O5Y- — CID 161020440
3-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,5-dimethyl-4H-pyrimidin-4-ide-2,6-dione;yttrium (PubChem CID 161020440) has the molecular formula C11H17N2O5Y- and a molecular weight of 346.17 g/mol. Its IUPAC name is 3-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,5-dimethyl-4H-pyrimidin-4-ide-2,6-dione;yttrium.
| Compound Name | 3-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,5-dimethyl-4H-pyrimidin-4-ide-2,6-dione;yttrium |
|---|---|
| PubChem CID | 161020440 |
| Molecular Formula | C11H17N2O5Y- |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,5-dimethyl-4H-pyrimidin-4-ide-2,6-dione;yttrium |
| SMILES | CC1(C)[CH-]N(C2CC(O)C(CO)O2)C(=O)NC1=O.[Y] |
| InChI | InChI=1S/C11H17N2O5.Y/c1-11(2)5-13(10(17)12-9(11)16)8-3-6(15)7(4-14)18-8;/h5-8,14-15H,3-4H2,1-2H3,(H,12,16,17);/q-1; |
| InChIKey | XXDOGZHYLQEQIZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|