C18H22N2O7 — CID 166679294
1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(hydroxymethoxy)phenyl]methoxy]-5-methylpyrimidin-2-one (PubChem CID 166679294) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(hydroxymethoxy)phenyl]methoxy]-5-methylpyrimidin-2-one.
| Compound Name | 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(hydroxymethoxy)phenyl]methoxy]-5-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 166679294 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-[[4-(hydroxymethoxy)phenyl]methoxy]-5-methylpyrimidin-2-one |
| SMILES | Cc1cn(C2CC(O)C(CO)O2)c(=O)nc1OCc1ccc(OCO)cc1 |
| InChI | InChI=1S/C18H22N2O7/c1-11-7-20(16-6-14(23)15(8-21)27-16)18(24)19-17(11)25-9-12-2-4-13(5-3-12)26-10-22/h2-5,7,14-16,21-23H,6,8-10H2,1H3 |
| InChIKey | XCOJDCDNZZPMKR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|