C22H30N5O8P — CID 59089352
[(2R,5R)-5-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-5,10-dihydrobenzo[g]quinazolin-3-yl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 59089352) has the molecular formula C22H30N5O8P and a molecular weight of 523.48 g/mol. Its IUPAC name is [(2R,5R)-5-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-5,10-dihydrobenzo[g]quinazolin-3-yl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-5-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-5,10-dihydrobenzo[g]quinazolin-3-yl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 59089352 |
| Molecular Formula | C22H30N5O8P |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [(2R,5R)-5-[9-[2-(diaminomethylideneamino)ethoxy]-2-oxo-5,10-dihydrobenzo[g]quinazolin-3-yl]-2-(methoxymethyl)oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COC[C@H]1O[C@@H](n2cc3c(nc2=O)Cc2c(cccc2OCCN=C(N)N)C3)CC1OP(=O)(O)OC |
| InChI | InChI=1S/C22H30N5O8P/c1-31-12-19-18(35-36(29,30)32-2)10-20(34-19)27-11-14-8-13-4-3-5-17(33-7-6-25-21(23)24)15(13)9-16(14)26-22(27)28/h3-5,11,18-20H,6-10,12H2,1-2H3,(H,29,30)(H4,23,24,25)/t18?,19-,20-/m1/s1 |
| InChIKey | BZLBAQALAXKIQR-FXJNCMGBSA-N |
| XLogP | 0.46 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|