C15H21N2O5P — CID 58427794
[(2R,5R)-2-(methoxymethyl)-5-(4-methylbenzimidazol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 58427794) has the molecular formula C15H21N2O5P and a molecular weight of 340.32 g/mol. Its IUPAC name is [(2R,5R)-2-(methoxymethyl)-5-(4-methylbenzimidazol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [(2R,5R)-2-(methoxymethyl)-5-(4-methylbenzimidazol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 58427794 |
| Molecular Formula | C15H21N2O5P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [(2R,5R)-2-(methoxymethyl)-5-(4-methylbenzimidazol-1-yl)oxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(C)cccc32)CC1OP(C)(=O)O |
| InChI | InChI=1S/C15H21N2O5P/c1-10-5-4-6-11-15(10)16-9-17(11)14-7-12(22-23(3,18)19)13(21-14)8-20-2/h4-6,9,12-14H,7-8H2,1-3H3,(H,18,19)/t12?,13-,14-/m1/s1 |
| InChIKey | LVPDRKBBRJCDGE-ILMHWDKJSA-N |
| XLogP | 2.48 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|