C15H23N5O9P2 — CID 59991695
[(2R,5R)-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]-5-[6-(prop-2-enylamino)purin-9-yl]oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 59991695) has the molecular formula C15H23N5O9P2 and a molecular weight of 479.32 g/mol. Its IUPAC name is [(2R,5R)-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]-5-[6-(prop-2-enylamino)purin-9-yl]oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,5R)-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]-5-[6-(prop-2-enylamino)purin-9-yl]oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 59991695 |
| Molecular Formula | C15H23N5O9P2 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [(2R,5R)-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]-5-[6-(prop-2-enylamino)purin-9-yl]oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | C=CCNc1ncnc2c1ncn2[C@H]1CC(OP(=O)(O)OC)[C@@H](COP(=O)(O)OC)O1 |
| InChI | InChI=1S/C15H23N5O9P2/c1-4-5-16-14-13-15(18-8-17-14)20(9-19-13)12-6-10(29-31(23,24)26-3)11(28-12)7-27-30(21,22)25-2/h4,8-12H,1,5-7H2,2-3H3,(H,21,22)(H,23,24)(H,16,17,18)/t10?,11-,12-/m1/s1 |
| InChIKey | SONIEGUDSDSGFE-PQDIPPBSSA-N |
| XLogP | 1.61 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|