C15H20FN2O5P — CID 58427805
[(2R,5R)-5-(4-fluoro-6-methylbenzimidazol-1-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 58427805) has the molecular formula C15H20FN2O5P and a molecular weight of 358.31 g/mol. Its IUPAC name is [(2R,5R)-5-(4-fluoro-6-methylbenzimidazol-1-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [(2R,5R)-5-(4-fluoro-6-methylbenzimidazol-1-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 58427805 |
| Molecular Formula | C15H20FN2O5P |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [(2R,5R)-5-(4-fluoro-6-methylbenzimidazol-1-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COC[C@H]1O[C@@H](n2cnc3c(F)cc(C)cc32)CC1OP(C)(=O)O |
| InChI | InChI=1S/C15H20FN2O5P/c1-9-4-10(16)15-11(5-9)18(8-17-15)14-6-12(23-24(3,19)20)13(22-14)7-21-2/h4-5,8,12-14H,6-7H2,1-3H3,(H,19,20)/t12?,13-,14-/m1/s1 |
| InChIKey | VNTTXSLDLHXLMT-ILMHWDKJSA-N |
| XLogP | 2.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|