C16H25N4O8P — CID 88946939
[(2R,5R)-5-[5-[(E)-3-(2-aminoethylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 88946939) has the molecular formula C16H25N4O8P and a molecular weight of 432.37 g/mol. Its IUPAC name is [(2R,5R)-5-[5-[(E)-3-(2-aminoethylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [(2R,5R)-5-[5-[(E)-3-(2-aminoethylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 88946939 |
| Molecular Formula | C16H25N4O8P |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(2R,5R)-5-[5-[(E)-3-(2-aminoethylamino)-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COC[C@H]1O[C@@H](n2cc(/C=C/C(=O)NCCN)c(=O)[nH]c2=O)CC1OP(C)(=O)O |
| InChI | InChI=1S/C16H25N4O8P/c1-26-9-12-11(28-29(2,24)25)7-14(27-12)20-8-10(15(22)19-16(20)23)3-4-13(21)18-6-5-17/h3-4,8,11-12,14H,5-7,9,17H2,1-2H3,(H,18,21)(H,24,25)(H,19,22,23)/b4-3+/t11?,12-,14-/m1/s1 |
| InChIKey | MEFTYTKHOONGMP-IXMKGKTESA-N |
| XLogP | -1.24 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|