C15H21N2O9P — CID 118243751
[(2R,3R,5R)-3-methoxy-5-[5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-methylphosphinic acid (PubChem CID 118243751) has the molecular formula C15H21N2O9P and a molecular weight of 404.31 g/mol. Its IUPAC name is [(2R,3R,5R)-3-methoxy-5-[5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-methylphosphinic acid.
| Compound Name | [(2R,3R,5R)-3-methoxy-5-[5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 118243751 |
| Molecular Formula | C15H21N2O9P |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [(2R,3R,5R)-3-methoxy-5-[5-[(E)-3-methoxy-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-methylphosphinic acid |
| SMILES | COC(=O)/C=C/c1cn([C@H]2C[C@@H](OC)[C@@H](COP(C)(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H21N2O9P/c1-23-10-6-12(26-11(10)8-25-27(3,21)22)17-7-9(4-5-13(18)24-2)14(19)16-15(17)20/h4-5,7,10-12H,6,8H2,1-3H3,(H,21,22)(H,16,19,20)/b5-4+/t10-,11-,12-/m1/s1 |
| InChIKey | GSJZYXZNCQMMEM-VWLQNONNSA-N |
| XLogP | -0.14 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|