C30H48FeN4O10P- — CID 162294503
cyclopentane;[5-[5-[(E)-3-[6-(cyclopentanecarbonylamino)hexylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl phosphate;iron (PubChem CID 162294503) has the molecular formula C30H48FeN4O10P- and a molecular weight of 711.55 g/mol. Its IUPAC name is cyclopentane;[5-[5-[(E)-3-[6-(cyclopentanecarbonylamino)hexylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl phosphate;iron.
| Compound Name | cyclopentane;[5-[5-[(E)-3-[6-(cyclopentanecarbonylamino)hexylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl phosphate;iron |
|---|---|
| PubChem CID | 162294503 |
| Molecular Formula | C30H48FeN4O10P- |
| Molecular Weight | 711.55 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | cyclopentane;[5-[5-[(E)-3-[6-(cyclopentanecarbonylamino)hexylamino]-3-oxoprop-1-enyl]-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl phosphate;iron |
| SMILES | C1CCCC1.COP(=O)([O-])OC1CC(n2cc(/C=C/C(=O)NCCCCCCNC(=O)C3CCCC3)c(=O)[nH]c2=O)OC1CO.[Fe] |
| InChI | InChI=1S/C25H39N4O10P.C5H10.Fe/c1-37-40(35,36)39-19-14-22(38-20(19)16-30)29-15-18(24(33)28-25(29)34)10-11-21(31)26-12-6-2-3-7-13-27-23(32)17-8-4-5-9-17;1-2-4-5-3-1;/h10-11,15,17,19-20,22,30H,2-9,12-14,16H2,1H3,(H,26,31)(H,27,32)(H,35,36)(H,28,33,34);1-5H2;/p-1/b11-10+;; |
| InChIKey | PPTSPNPIZRPMAG-BGNBUWATSA-M |
| XLogP | 2.26 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|