C18H29N2O8P — CID 163990096
[5-[2,4-dioxo-5-[(E)-prop-1-enyl]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl pentyl phosphate (PubChem CID 163990096) has the molecular formula C18H29N2O8P and a molecular weight of 432.41 g/mol. Its IUPAC name is [5-[2,4-dioxo-5-[(E)-prop-1-enyl]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl pentyl phosphate.
| Compound Name | [5-[2,4-dioxo-5-[(E)-prop-1-enyl]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl pentyl phosphate |
|---|---|
| PubChem CID | 163990096 |
| Molecular Formula | C18H29N2O8P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [5-[2,4-dioxo-5-[(E)-prop-1-enyl]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] methyl pentyl phosphate |
| SMILES | C/C=C/c1cn(C2CC(OP(=O)(OC)OCCCCC)C(CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N2O8P/c1-4-6-7-9-26-29(24,25-3)28-14-10-16(27-15(14)12-21)20-11-13(8-5-2)17(22)19-18(20)23/h5,8,11,14-16,21H,4,6-7,9-10,12H2,1-3H3,(H,19,22,23)/b8-5+ |
| InChIKey | TZVSXFXEZAAIRB-VMPITWQZSA-N |
| XLogP | 2.20 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|