C24H41N2O11P — CID 177241849
[(2R,3S,5R)-2-[[(E)-1-butoxy-4-hydroxy-4-methoxybut-3-en-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butyl methyl phosphate (PubChem CID 177241849) has the molecular formula C24H41N2O11P and a molecular weight of 564.57 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[(E)-1-butoxy-4-hydroxy-4-methoxybut-3-en-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butyl methyl phosphate.
| Compound Name | [(2R,3S,5R)-2-[[(E)-1-butoxy-4-hydroxy-4-methoxybut-3-en-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butyl methyl phosphate |
|---|---|
| PubChem CID | 177241849 |
| Molecular Formula | C24H41N2O11P |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | [(2R,3S,5R)-2-[[(E)-1-butoxy-4-hydroxy-4-methoxybut-3-en-2-yl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] butyl methyl phosphate |
| SMILES | CCCCOCC(/C=C(\O)OC)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1OP(=O)(OC)OCCCC |
| InChI | InChI=1S/C24H41N2O11P/c1-6-8-10-33-15-18(12-22(27)31-4)34-16-20-19(37-38(30,32-5)35-11-9-7-2)13-21(36-20)26-14-17(3)23(28)25-24(26)29/h12,14,18-21,27H,6-11,13,15-16H2,1-5H3,(H,25,28,29)/b22-12+/t18?,19-,20+,21+,38?/m0/s1 |
| InChIKey | QGBJSVCRBXNVTL-YJIIRVLFSA-N |
| XLogP | 3.34 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|